Compound Q&A

What industries use (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol (CAS: 114446-57-0)?

Answer

(1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol
(1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol is primarily used in the pharmaceutical industry, where it serves as a key intermediate in the synthesis of various drugs. It also finds applications in the sensor and semiconductor industries due to its specific chemical properties, making it a versatile molecule in modern chemistry.

About

English Name (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol
Molecular Formula C8H7Cl3O
Molecular Weight 225.502 g/mol
SMILES Clc1cc(Cl)ccc1[C@@H](O)CCl
InChIKey XHEPANNURIQWRM-QMMMGPOBSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol (CAS: 114446-57-0)?

(1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol is a colorless to light yellow crystalline solid with a ...

Compound Q&A

How is (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol (CAS: 114446-57-0) typically synthesized?

(1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol is often synthesized through a multistep process involvi...

Compound Q&A

What precautions should be taken when handling (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol (CAS: 114446-57-0)?

When handling (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol, it is crucial to wear appropriate persona...

Compound Q&A

What are the main uses of (3.beta.)-3-Hydroxy-N,N-dimethyl-chol-5-en-24-amide (CAS: 79066-03-8)?

(3.beta.)-3-Hydroxy-N,N-dimethyl-chol-5-en-24-amide (CAS: 79066-03-8) is primari...

79066-03-8(3.beta.)-3-Hydroxy-...
Compound Q&A

What regulatory guidelines apply to 5-(aminomethyl)-2-methoxyphenol (CAS: 89702-89-6)?

5-(Aminomethyl)-2-methoxyphenol (CAS: 89702-89-6) is classified under GHS as a s...

89702-89-65-(aminomethyl)-2-me...
Compound Q&A

What is Thieno[2,3-c]pyridin-7(6H)-one (CAS: 28981-13-7)?

Thieno[2,3-c]pyridin-7(6H)-one (CAS: 28981-13-7) is a heterocyclic organic compo...

28981-13-7Thieno[2,3-c]pyridin...
Compound Q&A

Is 1-[(6-Methoxy-3-pyridinyl)methyl]-4-piperidinamine dihydrochloride (CAS: 1185311-28-7) safe?

1-[(6-Methoxy-3-pyridinyl)methyl]-4-piperidinamine dihydrochloride is generally ...

1185311-28-71-[(6-Methoxy-3-pyri...