Compound Q&A

What industries use (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol (CAS: 114446-57-0)?

Answer

(1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol
(1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol is primarily used in the pharmaceutical industry, where it serves as a key intermediate in the synthesis of various drugs. It also finds applications in the sensor and semiconductor industries due to its specific chemical properties, making it a versatile molecule in modern chemistry.

About

English Name (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol
Molecular Formula C8H7Cl3O
Molecular Weight 225.5 g/mol
SMILES Clc1cc(Cl)ccc1[C@@H](O)CCl
InChIKey XHEPANNURIQWRM-QMMMGPOBSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol (CAS: 114446-57-0)?

(1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol is a colorless to light yellow crystalline solid with a ...

Compound Q&A

How is (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol (CAS: 114446-57-0) typically synthesized?

(1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol is often synthesized through a multistep process involvi...

Compound Q&A

What precautions should be taken when handling (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol (CAS: 114446-57-0)?

When handling (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol, it is crucial to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...