Compound Q&A

What are the physical and chemical properties of (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol (CAS: 114446-57-0)?

Answer

(1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol
(1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol is a colorless to light yellow crystalline solid with a molecular weight of approximately 287.04 g/mol. It has a low water solubility but is more soluble in organic solvents like ethanol and acetone. This compound is known for its reactivity in nucleophilic substitution reactions and its ability to form stable complexes with various metal ions.

About

English Name (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol
Molecular Formula C8H7Cl3O
Molecular Weight 225.502 g/mol
SMILES Clc1cc(Cl)ccc1[C@@H](O)CCl
InChIKey XHEPANNURIQWRM-QMMMGPOBSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

How is (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol (CAS: 114446-57-0) typically synthesized?

(1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol is often synthesized through a multistep process involvi...

Compound Q&A

What industries use (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol (CAS: 114446-57-0)?

(1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol is primarily used in the pharmaceutical industry, where ...

Compound Q&A

What precautions should be taken when handling (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol (CAS: 114446-57-0)?

When handling (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol, it is crucial to wear appropriate persona...

Compound Q&A

What are the main uses of (3.beta.)-3-Hydroxy-N,N-dimethyl-chol-5-en-24-amide (CAS: 79066-03-8)?

(3.beta.)-3-Hydroxy-N,N-dimethyl-chol-5-en-24-amide (CAS: 79066-03-8) is primari...

79066-03-8(3.beta.)-3-Hydroxy-...
Compound Q&A

What regulatory guidelines apply to 5-(aminomethyl)-2-methoxyphenol (CAS: 89702-89-6)?

5-(Aminomethyl)-2-methoxyphenol (CAS: 89702-89-6) is classified under GHS as a s...

89702-89-65-(aminomethyl)-2-me...
Compound Q&A

What is Thieno[2,3-c]pyridin-7(6H)-one (CAS: 28981-13-7)?

Thieno[2,3-c]pyridin-7(6H)-one (CAS: 28981-13-7) is a heterocyclic organic compo...

28981-13-7Thieno[2,3-c]pyridin...
Compound Q&A

Is 1-[(6-Methoxy-3-pyridinyl)methyl]-4-piperidinamine dihydrochloride (CAS: 1185311-28-7) safe?

1-[(6-Methoxy-3-pyridinyl)methyl]-4-piperidinamine dihydrochloride is generally ...

1185311-28-71-[(6-Methoxy-3-pyri...