Compound Q&A

What industries use 1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide (CAS: 1646818-35-0)?

Answer

1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide
This compound is primarily used in the pharmaceutical industry for its potential as a drug candidate, particularly in antiviral and anticancer research. It is also explored for its use in sensor technology and as a building block in polymer synthesis.

About

English Name 1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide
Molecular Formula C313C5H12N4O5
Molecular Weight 249.17 g/mol
SMILES NC(=O)C1N=CN(N=1)[13C@@H]1O[13CH]([13CH2]O)[13C@@H](O)[13C@H]1O
InChIKey IWUCXVSUMQZMFG-IWNSTHTFSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide (CAS: 1646818-35-0)?

This compound is a crystalline solid with a molecular weight of approximately 329.23 g/mol. It is sl...

Compound Q&A

How is 1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide (CAS: 1646818-35-0) typically synthesized?

This compound is synthesized via a multi-step process involving the protection of the sugar moiety, ...

Compound Q&A

What precautions should be taken when handling 1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide (CAS: 1646818-35-0)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...