Compound Q&A

What are the physical and chemical properties of 1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide (CAS: 1646818-35-0)?

Answer

1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide
This compound is a crystalline solid with a molecular weight of approximately 329.23 g/mol. It is slightly soluble in water and organic solvents. Chemically, it is reactive towards nucleophiles and exhibits good stability under neutral conditions. It has limited solubility in common solvents, making it suitable for applications requiring controlled reactivity.

About

English Name 1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide
Molecular Formula C313C5H12N4O5
Molecular Weight 249.17 g/mol
SMILES NC(=O)C1N=CN(N=1)[13C@@H]1O[13CH]([13CH2]O)[13C@@H](O)[13C@H]1O
InChIKey IWUCXVSUMQZMFG-IWNSTHTFSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

How is 1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide (CAS: 1646818-35-0) typically synthesized?

This compound is synthesized via a multi-step process involving the protection of the sugar moiety, ...

Compound Q&A

What industries use 1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide (CAS: 1646818-35-0)?

This compound is primarily used in the pharmaceutical industry for its potential as a drug candidate...

Compound Q&A

What precautions should be taken when handling 1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide (CAS: 1646818-35-0)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...