Compound Q&A

How is 1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide (CAS: 1646818-35-0) typically synthesized?

Answer

1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide
This compound is synthesized via a multi-step process involving the protection of the sugar moiety, followed by the introduction of the triazole ring and amide functional group. Common catalysts used include palladium and copper complexes. The final product is obtained with high selectivity and yield, typically around 80%.

About

English Name 1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide
Molecular Formula C313C5H12N4O5
Molecular Weight 249.17 g/mol
SMILES NC(=O)C1N=CN(N=1)[13C@@H]1O[13CH]([13CH2]O)[13C@@H](O)[13C@H]1O
InChIKey IWUCXVSUMQZMFG-IWNSTHTFSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide (CAS: 1646818-35-0)?

This compound is a crystalline solid with a molecular weight of approximately 329.23 g/mol. It is sl...

Compound Q&A

What industries use 1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide (CAS: 1646818-35-0)?

This compound is primarily used in the pharmaceutical industry for its potential as a drug candidate...

Compound Q&A

What precautions should be taken when handling 1-[(4xi)-beta-D-(~13~C_5_)-erythro-Pentofuranosyl]-1H-1,2,4-triazole-3-carboxamide (CAS: 1646818-35-0)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...