Compound Q&A

What industries use 1-(5-Nitro-2-pyridinyl)piperazine (CAS: 82205-58-1)?

Answer

1-(5-Nitro-2-pyridinyl)piperazine
1-(5-Nitro-2-pyridinyl)piperazine is primarily used in the pharmaceutical industry as a precursor for drug development. It is also utilized in the synthesis of polymers with specific properties and in the production of sensors for detecting various analytes. Additionally, it has applications in the semiconductor industry for its role in material preparation.

About

CAS No 82205-58-1
English Name 1-(5-Nitro-2-pyridinyl)piperazine
Molecular Formula C9H12N4O2
Molecular Weight 208.22 g/mol
SMILES C1CN(CCN1)C2=NC=C(C=C2)[N+](=O)[O-]
InChIKey YEPRCPIKTUGVHG-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(5-Nitro-2-pyridinyl)piperazine (CAS: 82205-58-1)?

1-(5-Nitro-2-pyridinyl)piperazine is a crystalline solid with a molecular weight of approximately 23...

Compound Q&A

How is 1-(5-Nitro-2-pyridinyl)piperazine (CAS: 82205-58-1) typically synthesized?

1-(5-Nitro-2-pyridinyl)piperazine is often synthesized through a multistep process involving the rea...

Compound Q&A

What precautions should be taken when handling 1-(5-Nitro-2-pyridinyl)piperazine (CAS: 82205-58-1)?

When handling 1-(5-Nitro-2-pyridinyl)piperazine, it is essential to use personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...