Compound Q&A

How is 1-(5-Nitro-2-pyridinyl)piperazine (CAS: 82205-58-1) typically synthesized?

Answer

1-(5-Nitro-2-pyridinyl)piperazine
1-(5-Nitro-2-pyridinyl)piperazine is often synthesized through a multistep process involving the reaction of piperazine with 5-nitropyridine in the presence of a base such as potassium carbonate. The yield is typically around 70-80%, with good selectivity to the desired product. The exact method can vary depending on the specific laboratory and equipment available.

About

CAS No 82205-58-1
English Name 1-(5-Nitro-2-pyridinyl)piperazine
Molecular Formula C9H12N4O2
Molecular Weight 208.22 g/mol
SMILES C1CN(CCN1)C2=NC=C(C=C2)[N+](=O)[O-]
InChIKey YEPRCPIKTUGVHG-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(5-Nitro-2-pyridinyl)piperazine (CAS: 82205-58-1)?

1-(5-Nitro-2-pyridinyl)piperazine is a crystalline solid with a molecular weight of approximately 23...

Compound Q&A

What industries use 1-(5-Nitro-2-pyridinyl)piperazine (CAS: 82205-58-1)?

1-(5-Nitro-2-pyridinyl)piperazine is primarily used in the pharmaceutical industry as a precursor fo...

Compound Q&A

What precautions should be taken when handling 1-(5-Nitro-2-pyridinyl)piperazine (CAS: 82205-58-1)?

When handling 1-(5-Nitro-2-pyridinyl)piperazine, it is essential to use personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...