Compound Q&A

What are the physical and chemical properties of 1-(5-Nitro-2-pyridinyl)piperazine (CAS: 82205-58-1)?

Answer

1-(5-Nitro-2-pyridinyl)piperazine
1-(5-Nitro-2-pyridinyl)piperazine is a crystalline solid with a molecular weight of approximately 231.13 g/mol. It has a solubility of about 10 mg/mL in water and is soluble in organic solvents such as methanol. Chemically, it is reactive towards nucleophiles and can undergo substitution reactions. It exhibits good stability under normal conditions but requires storage in a cool, dry place away from moisture.

About

CAS No 82205-58-1
English Name 1-(5-Nitro-2-pyridinyl)piperazine
Molecular Formula C9H12N4O2
Molecular Weight 208.22 g/mol
SMILES C1CN(CCN1)C2=NC=C(C=C2)[N+](=O)[O-]
InChIKey YEPRCPIKTUGVHG-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 1-(5-Nitro-2-pyridinyl)piperazine (CAS: 82205-58-1) typically synthesized?

1-(5-Nitro-2-pyridinyl)piperazine is often synthesized through a multistep process involving the rea...

Compound Q&A

What industries use 1-(5-Nitro-2-pyridinyl)piperazine (CAS: 82205-58-1)?

1-(5-Nitro-2-pyridinyl)piperazine is primarily used in the pharmaceutical industry as a precursor fo...

Compound Q&A

What precautions should be taken when handling 1-(5-Nitro-2-pyridinyl)piperazine (CAS: 82205-58-1)?

When handling 1-(5-Nitro-2-pyridinyl)piperazine, it is essential to use personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...