Compound Q&A

What industries use 5-Bromo-2-fluorocinnamic acid (CAS: 202865-71-2)?

Answer

5-Bromo-2-fluorocinnamic acid
5-Bromo-2-fluorocinnamic acid is primarily used in the pharmaceutical industry for the synthesis of drug candidates. It also finds applications in the polymer industry for the development of functional materials, and in the semiconductor industry for the production of materials used in sensor technologies.

About

English Name 5-Bromo-2-fluorocinnamic acid
Molecular Formula C9H6BrFO2
Molecular Weight 245.05 g/mol
SMILES C1=CC(=C(C=C1Br)C=CC(=O)O)F
InChIKey ROTBALNVXDGIQY-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-fluorocinnamic acid (CAS: 202865-71-2)?

5-Bromo-2-fluorocinnamic acid is a crystalline solid with a molecular weight of approximately 241.02...

Compound Q&A

How is 5-Bromo-2-fluorocinnamic acid (CAS: 202865-71-2) typically synthesized?

5-Bromo-2-fluorocinnamic acid is synthesized through a series of steps, starting with 2-fluorocinnam...

Compound Q&A

What precautions should be taken when handling 5-Bromo-2-fluorocinnamic acid (CAS: 202865-71-2)?

When handling 5-Bromo-2-fluorocinnamic acid, it is important to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...