Compound Q&A

How is 5-Bromo-2-fluorocinnamic acid (CAS: 202865-71-2) typically synthesized?

Answer

5-Bromo-2-fluorocinnamic acid
5-Bromo-2-fluorocinnamic acid is synthesized through a series of steps, starting with 2-fluorocinnamic acid. Bromination is achieved using bromine in the presence of a Lewis acid like aluminum bromide. The reaction is typically carried out in an inert solvent like dichloromethane, with a yield of around 70-80% and good selectivity.

About

English Name 5-Bromo-2-fluorocinnamic acid
Molecular Formula C9H6BrFO2
Molecular Weight 245.05 g/mol
SMILES C1=CC(=C(C=C1Br)C=CC(=O)O)F
InChIKey ROTBALNVXDGIQY-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-fluorocinnamic acid (CAS: 202865-71-2)?

5-Bromo-2-fluorocinnamic acid is a crystalline solid with a molecular weight of approximately 241.02...

Compound Q&A

What industries use 5-Bromo-2-fluorocinnamic acid (CAS: 202865-71-2)?

5-Bromo-2-fluorocinnamic acid is primarily used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling 5-Bromo-2-fluorocinnamic acid (CAS: 202865-71-2)?

When handling 5-Bromo-2-fluorocinnamic acid, it is important to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...