Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-fluorocinnamic acid (CAS: 202865-71-2)?

Answer

5-Bromo-2-fluorocinnamic acid
5-Bromo-2-fluorocinnamic acid is a crystalline solid with a molecular weight of approximately 241.02 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and acetone. Chemically, it is moderately reactive, especially towards nucleophiles. It is commonly used in organic synthesis and medicinal chemistry.

About

English Name 5-Bromo-2-fluorocinnamic acid
Molecular Formula C9H6BrFO2
Molecular Weight 245.05 g/mol
SMILES C1=CC(=C(C=C1Br)C=CC(=O)O)F
InChIKey ROTBALNVXDGIQY-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 5-Bromo-2-fluorocinnamic acid (CAS: 202865-71-2) typically synthesized?

5-Bromo-2-fluorocinnamic acid is synthesized through a series of steps, starting with 2-fluorocinnam...

Compound Q&A

What industries use 5-Bromo-2-fluorocinnamic acid (CAS: 202865-71-2)?

5-Bromo-2-fluorocinnamic acid is primarily used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling 5-Bromo-2-fluorocinnamic acid (CAS: 202865-71-2)?

When handling 5-Bromo-2-fluorocinnamic acid, it is important to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...