Compound Q&A

How is (1S)-1-Amino-4-indanecarbonitrile hydrochloride (CAS: 1306763-57-4) typically synthesized?

Answer

(1S)-1-Amino-4-indanecarbonitrile hydrochloride (1:1)
(1S)-1-Amino-4-indanecarbonitrile hydrochloride is synthesized via the reaction of 4-indanone with sodium cyanide in the presence of an acid catalyst. The process typically yields a product with high selectivity and good yield. The reaction is carried out in a solvent like acetonitrile, and the hydrochloride salt is formed by neutralizing the amine with hydrochloric acid.

About

English Name (1S)-1-Amino-4-indanecarbonitrile hydrochloride (1:1)
Molecular Formula C10H11ClN2
Molecular Weight 147.22 g/mol
SMILES c1cc(c2c(c1)[C@H](CC2)N)C#N.Cl
InChIKey NYCLSOKJNLLCHQ-PPHPATTJSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1S)-1-Amino-4-indanecarbonitrile hydrochloride (CAS: 1306763-57-4)?

(1S)-1-Amino-4-indanecarbonitrile hydrochloride is a white crystalline solid with a molecular weight...

Compound Q&A

What industries use (1S)-1-Amino-4-indanecarbonitrile hydrochloride (CAS: 1306763-57-4)?

(1S)-1-Amino-4-indanecarbonitrile hydrochloride is primarily used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling (1S)-1-Amino-4-indanecarbonitrile hydrochloride (CAS: 1306763-57-4)?

When handling (1S)-1-Amino-4-indanecarbonitrile hydrochloride, it is crucial to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...