Compound Q&A

What are the physical and chemical properties of (1S)-1-Amino-4-indanecarbonitrile hydrochloride (CAS: 1306763-57-4)?

Answer

(1S)-1-Amino-4-indanecarbonitrile hydrochloride (1:1)
(1S)-1-Amino-4-indanecarbonitrile hydrochloride is a white crystalline solid with a molecular weight of approximately 258.24 g/mol. It has a low water solubility but is soluble in organic solvents like methanol and ethanol. Chemically, it is stable but can react under basic conditions. It is often used in pharmaceutical research and synthesis applications.

About

English Name (1S)-1-Amino-4-indanecarbonitrile hydrochloride (1:1)
Molecular Formula C10H11ClN2
Molecular Weight 147.22 g/mol
SMILES c1cc(c2c(c1)[C@H](CC2)N)C#N.Cl
InChIKey NYCLSOKJNLLCHQ-PPHPATTJSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is (1S)-1-Amino-4-indanecarbonitrile hydrochloride (CAS: 1306763-57-4) typically synthesized?

(1S)-1-Amino-4-indanecarbonitrile hydrochloride is synthesized via the reaction of 4-indanone with s...

Compound Q&A

What industries use (1S)-1-Amino-4-indanecarbonitrile hydrochloride (CAS: 1306763-57-4)?

(1S)-1-Amino-4-indanecarbonitrile hydrochloride is primarily used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling (1S)-1-Amino-4-indanecarbonitrile hydrochloride (CAS: 1306763-57-4)?

When handling (1S)-1-Amino-4-indanecarbonitrile hydrochloride, it is crucial to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...