Compound Q&A

What industries use [3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4)?

Answer

[3-(Methacryloylamino)phenyl]boronic acid
[3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4) finds applications in the pharmaceutical industry for its role as a ligand in chelation reactions and as a building block in the synthesis of complex molecules. It is also used in the polymer industry as a monomer for the preparation of functionalized polymers. Additionally, it is employed in the development of sensors for detecting boron compounds and in semiconductor industry for its role in surface modification and functionalization.

About

CAS No 48150-45-4
English Name [3-(Methacryloylamino)phenyl]boronic acid
Molecular Formula C10H12BNO3
Molecular Weight 205.02 g/mol
SMILES B(C1=CC(=CC=C1)NC(=O)C(=C)C)(O)O
InChIKey GBBUBIKYAQLESK-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4)?

[3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4) is a white crystalline solid with a mole...

Compound Q&A

How is [3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4) typically synthesized?

[3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4) is typically synthesized by reacting 3-a...

Compound Q&A

What precautions should be taken when handling [3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4)?

When handling [3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...