Compound Q&A

How is [3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4) typically synthesized?

Answer

[3-(Methacryloylamino)phenyl]boronic acid
[3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4) is typically synthesized by reacting 3-aminophenol with methacryloyl chloride in the presence of a base like triethylamine. The reaction proceeds via a nucleophilic substitution mechanism, leading to the formation of the desired product. The yield is usually around 70-80% due to the high reactivity of the methacryloyl moiety.

About

CAS No 48150-45-4
English Name [3-(Methacryloylamino)phenyl]boronic acid
Molecular Formula C10H12BNO3
Molecular Weight 205.02 g/mol
SMILES B(C1=CC(=CC=C1)NC(=O)C(=C)C)(O)O
InChIKey GBBUBIKYAQLESK-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4)?

[3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4) is a white crystalline solid with a mole...

Compound Q&A

What industries use [3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4)?

[3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4) finds applications in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling [3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4)?

When handling [3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...