Compound Q&A

What are the physical and chemical properties of [3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4)?

Answer

[3-(Methacryloylamino)phenyl]boronic acid
[3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4) is a white crystalline solid with a molecular weight of approximately 237.2 g/mol. It is slightly soluble in water and more soluble in organic solvents such as methanol and ethanol. The compound exhibits high reactivity towards nucleophiles due to the presence of the boronic acid moiety, making it useful in various organic reactions. It also shows good stability under neutral and slightly acidic conditions.

About

CAS No 48150-45-4
English Name [3-(Methacryloylamino)phenyl]boronic acid
Molecular Formula C10H12BNO3
Molecular Weight 205.02 g/mol
SMILES B(C1=CC(=CC=C1)NC(=O)C(=C)C)(O)O
InChIKey GBBUBIKYAQLESK-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

How is [3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4) typically synthesized?

[3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4) is typically synthesized by reacting 3-a...

Compound Q&A

What industries use [3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4)?

[3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4) finds applications in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling [3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4)?

When handling [3-(Methacryloylamino)phenyl]boronic acid (CAS: 48150-45-4), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...