Compound Q&A

What industries use 1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0)?

Answer

1,2,3,4-Tetrachloro-5-nitrobenzene
1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0) is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those requiring chlorinated and nitro functionalities. It is also utilized in the production of chemical intermediates and for the development of sensors and other specialized applications.

About

CAS No 879-39-0
English Name 1,2,3,4-Tetrachloro-5-nitrobenzene
Molecular Formula C6HCl4NO2
Molecular Weight 260.89 g/mol
SMILES Clc1cc(N(=O)=O)c(c(c1Cl)Cl)Cl
InChIKey MTBYTWZDRVOMBR-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0)?

1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0) is a crystalline solid with a molecular weight of...

Compound Q&A

How is 1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0) typically synthesized?

1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0) is synthesized through the chlorination of 1-nitr...

Compound Q&A

What precautions should be taken when handling 1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0)?

When handling 1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0), it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...