Compound Q&A

How is 1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0) typically synthesized?

Answer

1,2,3,4-Tetrachloro-5-nitrobenzene
1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0) is synthesized through the chlorination of 1-nitrobenzene followed by further chlorination. Commonly, this involves the reaction of 1-nitrobenzene with chlorine gas in the presence of a Lewis acid catalyst like aluminum chloride. The final step involves another chlorination to introduce the fourth chlorine atom.

About

CAS No 879-39-0
English Name 1,2,3,4-Tetrachloro-5-nitrobenzene
Molecular Formula C6HCl4NO2
Molecular Weight 260.89 g/mol
SMILES Clc1cc(N(=O)=O)c(c(c1Cl)Cl)Cl
InChIKey MTBYTWZDRVOMBR-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0)?

1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0) is a crystalline solid with a molecular weight of...

Compound Q&A

What industries use 1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0)?

1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0) is used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling 1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0)?

When handling 1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0), it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...