Compound Q&A

What are the physical and chemical properties of 1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0)?

Answer

1,2,3,4-Tetrachloro-5-nitrobenzene
1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0) is a crystalline solid with a molecular weight of approximately 286.01 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. This compound is moderately reactive, particularly towards nucleophilic substitution and reduction reactions. It decomposes upon heating and is sensitive to light.

About

CAS No 879-39-0
English Name 1,2,3,4-Tetrachloro-5-nitrobenzene
Molecular Formula C6HCl4NO2
Molecular Weight 260.89 g/mol
SMILES Clc1cc(N(=O)=O)c(c(c1Cl)Cl)Cl
InChIKey MTBYTWZDRVOMBR-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

How is 1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0) typically synthesized?

1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0) is synthesized through the chlorination of 1-nitr...

Compound Q&A

What industries use 1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0)?

1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0) is used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling 1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0)?

When handling 1,2,3,4-Tetrachloro-5-nitrobenzene (CAS: 879-39-0), it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...