Compound Q&A

What industries use Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4)?

Answer

Methyl 2-amino-5-nitrobenzoate
Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4) is used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also used in the polymer industry as a stabilizer and in the electronics industry for the production of sensors and semiconductors. Its use in these industries is primarily due to its unique chemical functionality and reactivity.

About

CAS No 3816-62-4
English Name Methyl 2-amino-5-nitrobenzoate
Molecular Formula C8H8N2O4
Molecular Weight 196.16 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])N
InChIKey VOQBLPBLKSXCDB-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4)?

Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4) is a solid, crystalline compound. Its molecular weig...

Compound Q&A

How is Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4) typically synthesized?

Methyl 2-amino-5-nitrobenzoate is typically synthesized via the nitration of methyl 2-aminobenzoate....

Compound Q&A

What precautions should be taken when handling Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4)?

When handling Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4), appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...