Compound Q&A

How is Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4) typically synthesized?

Answer

Methyl 2-amino-5-nitrobenzoate
Methyl 2-amino-5-nitrobenzoate is typically synthesized via the nitration of methyl 2-aminobenzoate. This process involves reacting methyl 2-aminobenzoate with nitric acid in the presence of a catalyst such as sulfuric acid. The nitration step yields the target compound with good yield and selectivity. The process requires careful control of temperature and reaction time to avoid side reactions.

About

CAS No 3816-62-4
English Name Methyl 2-amino-5-nitrobenzoate
Molecular Formula C8H8N2O4
Molecular Weight 196.16 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])N
InChIKey VOQBLPBLKSXCDB-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4)?

Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4) is a solid, crystalline compound. Its molecular weig...

Compound Q&A

What industries use Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4)?

Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4) is used in the pharmaceutical industry as an interme...

Compound Q&A

What precautions should be taken when handling Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4)?

When handling Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4), appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...