Compound Q&A

What are the physical and chemical properties of Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4)?

Answer

Methyl 2-amino-5-nitrobenzoate
Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4) is a solid, crystalline compound. Its molecular weight is approximately 216.14 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is known for its stability in neutral and slightly acidic solutions. It is not highly reactive under normal conditions but may undergo nitro group reduction under reducing conditions.

About

CAS No 3816-62-4
English Name Methyl 2-amino-5-nitrobenzoate
Molecular Formula C8H8N2O4
Molecular Weight 196.16 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])N
InChIKey VOQBLPBLKSXCDB-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

How is Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4) typically synthesized?

Methyl 2-amino-5-nitrobenzoate is typically synthesized via the nitration of methyl 2-aminobenzoate....

Compound Q&A

What industries use Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4)?

Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4) is used in the pharmaceutical industry as an interme...

Compound Q&A

What precautions should be taken when handling Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4)?

When handling Methyl 2-amino-5-nitrobenzoate (CAS: 3816-62-4), appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...