Compound Q&A

What industries use Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate (CAS: 133409-72-0)?

Answer

Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate
Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate is primarily used in the pharmaceutical industry for synthesizing certain drug precursors. It also finds applications in the polymer industry for functionalizing polymers. Additionally, it can be used in the production of sensors and as a precursor in semiconductor manufacturing processes for specific chemical treatments.

About

English Name Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate
Molecular Formula C11H12BrNO3
Molecular Weight 286.12 g/mol
SMILES CO/N=C(\c1ccccc1CBr)/C(=O)OC
InChIKey LDPXOYHMGOQPIV-JLHYYAGUSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate (CAS: 133409-72-0)?

Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate is a colorless to light yellow oil at room ...

Compound Q&A

How is Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate (CAS: 133409-72-0) typically synthesized?

Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate is typically synthesized via a multi-step p...

Compound Q&A

What precautions should be taken when handling Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate (CAS: 133409-72-0)?

When handling Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate, appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...