Compound Q&A

What are the physical and chemical properties of Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate (CAS: 133409-72-0)?

Answer

Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate
Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate is a colorless to light yellow oil at room temperature. Its molecular weight is approximately 352.1 g/mol. It has limited solubility in water but is soluble in organic solvents like ethanol and acetone. This compound is relatively stable under normal conditions but can react with basic substances to form byproducts. It is mildly reactive towards nucleophiles.

About

English Name Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate
Molecular Formula C11H12BrNO3
Molecular Weight 286.12 g/mol
SMILES CO/N=C(\c1ccccc1CBr)/C(=O)OC
InChIKey LDPXOYHMGOQPIV-JLHYYAGUSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate (CAS: 133409-72-0) typically synthesized?

Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate is typically synthesized via a multi-step p...

Compound Q&A

What industries use Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate (CAS: 133409-72-0)?

Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate (CAS: 133409-72-0)?

When handling Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate, appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...