Compound Q&A

How is Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate (CAS: 133409-72-0) typically synthesized?

Answer

Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate
Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate is typically synthesized via a multi-step process involving the bromination of a phenylacetate followed by a Wittig reaction. The key steps include bromination of the phenyl group, followed by reaction with a methoxyimino compound to form the desired ester. Common catalysts and reagents include NBS (N-bromosuccinimide) and methoxyimino compounds. The overall yield is moderate to good, depending on the purity of starting materials and reaction conditions.

About

English Name Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate
Molecular Formula C11H12BrNO3
Molecular Weight 286.12 g/mol
SMILES CO/N=C(\c1ccccc1CBr)/C(=O)OC
InChIKey LDPXOYHMGOQPIV-JLHYYAGUSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate (CAS: 133409-72-0)?

Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate is a colorless to light yellow oil at room ...

Compound Q&A

What industries use Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate (CAS: 133409-72-0)?

Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate (CAS: 133409-72-0)?

When handling Methyl (2E)-[2-(bromomethyl)phenyl](methoxyimino)acetate, appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...