Compound Q&A

What precautions should be taken when handling Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7)?

Answer

Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate
When handling Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7), it is essential to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. This compound should be handled in a well-ventilated area or a fume hood to minimize exposure to vapors. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be thoroughly washed down. Always consult the Material Safety Data Sheet (MSDS) for detailed safety information.

About

English Name Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate
Molecular Formula C9H7F3INO2
Molecular Weight 345.06 g/mol
SMILES COC(=O)c1cc(I)c(cc1N)C(F)(F)F
InChIKey ILCBGAMVQYUDFL-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7)?

Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7) is a crystalline solid with a m...

Compound Q&A

How is Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7) typically synthesized?

Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7) is typically synthesized throug...

Compound Q&A

What industries use Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7)?

Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7) is primarily used in the pharma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...