Compound Q&A

What industries use Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7)?

Answer

Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate
Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7) is primarily used in the pharmaceutical industry for the synthesis of novel drugs. It is also used in the development of materials for sensors and semiconductors, due to its unique chemical properties.

About

English Name Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate
Molecular Formula C9H7F3INO2
Molecular Weight 345.06 g/mol
SMILES COC(=O)c1cc(I)c(cc1N)C(F)(F)F
InChIKey ILCBGAMVQYUDFL-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7)?

Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7) is a crystalline solid with a m...

Compound Q&A

How is Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7) typically synthesized?

Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7) is typically synthesized throug...

Compound Q&A

What precautions should be taken when handling Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7)?

When handling Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...