Compound Q&A

What are the physical and chemical properties of Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7)?

Answer

Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate
Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7) is a crystalline solid with a molecular weight of approximately 435.85 g/mol. It has a low solubility in water but is soluble in organic solvents. The compound is reactive towards nucleophiles but stable under acidic conditions. It is used in the synthesis of pharmaceuticals and other organic compounds.

About

English Name Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate
Molecular Formula C9H7F3INO2
Molecular Weight 345.06 g/mol
SMILES COC(=O)c1cc(I)c(cc1N)C(F)(F)F
InChIKey ILCBGAMVQYUDFL-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7) typically synthesized?

Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7) is typically synthesized throug...

Compound Q&A

What industries use Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7)?

Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7) is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7)?

When handling Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...