Compound Q&A

How is Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7) typically synthesized?

Answer

Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate
Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7) is typically synthesized through a multistep process involving the iodination of 4-(trifluoromethyl)benzoic acid followed by alkylation with methylamine. The reaction is carried out in the presence of a base, such as sodium hydride, and a catalyst. The yield and selectivity of the reaction are influenced by the choice of reagents and reaction conditions.

About

English Name Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate
Molecular Formula C9H7F3INO2
Molecular Weight 345.06 g/mol
SMILES COC(=O)c1cc(I)c(cc1N)C(F)(F)F
InChIKey ILCBGAMVQYUDFL-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7)?

Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7) is a crystalline solid with a m...

Compound Q&A

What industries use Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7)?

Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7) is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7)?

When handling Methyl 2-amino-5-iodo-4-(trifluoromethyl)benzoate (CAS: 872624-52-7), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...