Compound Q&A

What precautions should be taken when handling 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6)?

Answer

4-Bromo-1-benzothiophene-2-carboxylic acid
When handling 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6), wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a fume hood and ensure proper ventilation. Spills should be cleaned up carefully, and consult the Safety Data Sheet (SDS) for specific instructions. This compound may cause irritation and should be handled with care to avoid exposure.

About

CAS No 5194-37-6
English Name 4-Bromo-1-benzothiophene-2-carboxylic acid
Molecular Formula C9H5BrO2S
Molecular Weight 257.11 g/mol
SMILES C1=CC2=C(C=C(S2)C(=O)O)C(=C1)Br
InChIKey LAYNZUFIYSYHIV-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6)?

4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6) has a crystalline form and a molecular w...

Compound Q&A

How is 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6) typically synthesized?

4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6) is typically synthesized by bromination ...

Compound Q&A

What industries use 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6)?

4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6) is used in various industries, particula...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...