Compound Q&A

What are the physical and chemical properties of 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6)?

Answer

4-Bromo-1-benzothiophene-2-carboxylic acid
4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6) has a crystalline form and a molecular weight of approximately 269.02 g/mol. It is slightly soluble in water and more soluble in organic solvents like ethanol and acetonitrile. Chemically, it is reactive, particularly towards nucleophiles and electrophiles, and is often used in synthetic chemistry due to its bromine substituent.

About

CAS No 5194-37-6
English Name 4-Bromo-1-benzothiophene-2-carboxylic acid
Molecular Formula C9H5BrO2S
Molecular Weight 257.11 g/mol
SMILES C1=CC2=C(C=C(S2)C(=O)O)C(=C1)Br
InChIKey LAYNZUFIYSYHIV-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6) typically synthesized?

4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6) is typically synthesized by bromination ...

Compound Q&A

What industries use 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6)?

4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6) is used in various industries, particula...

Compound Q&A

What precautions should be taken when handling 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6)?

When handling 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6), wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...