Compound Q&A

How is 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6) typically synthesized?

Answer

4-Bromo-1-benzothiophene-2-carboxylic acid
4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6) is typically synthesized by bromination of 1-benzothiophene-2-carboxylic acid using N-bromosuccinimide (NBS) in an appropriate solvent like dichloromethane (DCM). The reaction is usually conducted under light or heat and is highly selective for the bromination at the desired position.

About

CAS No 5194-37-6
English Name 4-Bromo-1-benzothiophene-2-carboxylic acid
Molecular Formula C9H5BrO2S
Molecular Weight 257.11 g/mol
SMILES C1=CC2=C(C=C(S2)C(=O)O)C(=C1)Br
InChIKey LAYNZUFIYSYHIV-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6)?

4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6) has a crystalline form and a molecular w...

Compound Q&A

What industries use 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6)?

4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6) is used in various industries, particula...

Compound Q&A

What precautions should be taken when handling 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6)?

When handling 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6), wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...