Compound Q&A

What industries use 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6)?

Answer

4-Bromo-1-benzothiophene-2-carboxylic acid
4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6) is used in various industries, particularly in pharmaceuticals and materials science. It serves as a key intermediate for the development of new drugs and is also employed in the synthesis of sensors and semiconductors due to its unique chemical properties.

About

CAS No 5194-37-6
English Name 4-Bromo-1-benzothiophene-2-carboxylic acid
Molecular Formula C9H5BrO2S
Molecular Weight 257.11 g/mol
SMILES C1=CC2=C(C=C(S2)C(=O)O)C(=C1)Br
InChIKey LAYNZUFIYSYHIV-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6)?

4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6) has a crystalline form and a molecular w...

Compound Q&A

How is 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6) typically synthesized?

4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6) is typically synthesized by bromination ...

Compound Q&A

What precautions should be taken when handling 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6)?

When handling 4-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 5194-37-6), wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...