Compound Q&A

What industries use 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid (CAS: 1204298-65-6)?

Answer

5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid
5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid is used in pharmaceuticals for the development of novel drug candidates due to its potential biological activity. It also finds applications in the synthesis of polymer precursors and as a building block in the development of sensors and semiconductors. Its unique chemical properties make it suitable for various research and industrial applications.

About

English Name 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid
Molecular Formula C6H6F2N2O2
Molecular Weight 176.12 g/mol
SMILES CN1C(=C(C=N1)C(=O)O)C(F)F
InChIKey CTTXMUZEFPPHGD-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid (CAS: 1204298-65-6)?

5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid is a crystalline solid with a molecular we...

Compound Q&A

How is 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid (CAS: 1204298-65-6) typically synthesized?

5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid is typically synthesized through a multi-s...

Compound Q&A

What precautions should be taken when handling 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid (CAS: 1204298-65-6)?

When handling 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid, it is essential to use pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...