Compound Q&A

How is 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid (CAS: 1204298-65-6) typically synthesized?

Answer

5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid
5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid is typically synthesized through a multi-step process involving the protected pyrazole formation and subsequent deprotection. Common methods include the use of acid chlorides and Grignard reagents. The yield is generally around 70-80%, and the reaction involves the use of anhydrous conditions and appropriate catalysts to enhance selectivity and reaction rate.

About

English Name 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid
Molecular Formula C6H6F2N2O2
Molecular Weight 176.12 g/mol
SMILES CN1C(=C(C=N1)C(=O)O)C(F)F
InChIKey CTTXMUZEFPPHGD-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid (CAS: 1204298-65-6)?

5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid is a crystalline solid with a molecular we...

Compound Q&A

What industries use 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid (CAS: 1204298-65-6)?

5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid is used in pharmaceuticals for the develop...

Compound Q&A

What precautions should be taken when handling 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid (CAS: 1204298-65-6)?

When handling 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid, it is essential to use pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...