Compound Q&A

What are the physical and chemical properties of 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid (CAS: 1204298-65-6)?

Answer

5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid
5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid is a crystalline solid with a molecular weight of approximately 213.03 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and acetonitrile. The compound exhibits moderate acidity and can form hydrogen bonds, making it susceptible to hydrolysis under basic conditions. It is also reactive towards nucleophiles and can undergo electrophilic aromatic substitution reactions.

About

English Name 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid
Molecular Formula C6H6F2N2O2
Molecular Weight 176.12 g/mol
SMILES CN1C(=C(C=N1)C(=O)O)C(F)F
InChIKey CTTXMUZEFPPHGD-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid (CAS: 1204298-65-6) typically synthesized?

5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid is typically synthesized through a multi-s...

Compound Q&A

What industries use 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid (CAS: 1204298-65-6)?

5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid is used in pharmaceuticals for the develop...

Compound Q&A

What precautions should be taken when handling 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid (CAS: 1204298-65-6)?

When handling 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid, it is essential to use pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...