Compound Q&A

What precautions should be taken when handling 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9)?

Answer

4-Aminobenzotrifluoride hydrochloride
When handling 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9), ensure the use of appropriate personal protective equipment (PPE) including gloves, safety goggles, and lab coat. This compound should be stored in a cool, dry location away from direct sunlight and flammable materials. Always work in a fume hood to minimize inhalation risks. Refer to the safety data sheet (SDS) for detailed safety information.

About

CAS No 90774-69-9
English Name 4-Aminobenzotrifluoride hydrochloride
Molecular Formula C7H7ClF3N
Molecular Weight 197.59 g/mol
SMILES C1=CC(=CC=C1C(F)(F)F)N.Cl
InChIKey CZGDYZDUMJDQSD-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9)?

4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9) is a crystalline solid with a molecular weig...

Compound Q&A

How is 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9) typically synthesized?

4-Aminobenzotrifluoride hydrochloride is commonly synthesized through the reaction of 4-bromobenzotr...

Compound Q&A

What industries use 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9)?

4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9) is primarily used in the pharmaceutical indu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...