Compound Q&A

What are the physical and chemical properties of 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9)?

Answer

4-Aminobenzotrifluoride hydrochloride
4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9) is a crystalline solid with a molecular weight of approximately 289.91 g/mol. It is slightly soluble in water and highly soluble in organic solvents like DMSO and DMF. This compound is known for its high reactivity, particularly in nucleophilic aromatic substitution reactions.

About

CAS No 90774-69-9
English Name 4-Aminobenzotrifluoride hydrochloride
Molecular Formula C7H7ClF3N
Molecular Weight 197.59 g/mol
SMILES C1=CC(=CC=C1C(F)(F)F)N.Cl
InChIKey CZGDYZDUMJDQSD-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9) typically synthesized?

4-Aminobenzotrifluoride hydrochloride is commonly synthesized through the reaction of 4-bromobenzotr...

Compound Q&A

What industries use 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9)?

4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9) is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9)?

When handling 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9), ensure the use of appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...