Compound Q&A

How is 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9) typically synthesized?

Answer

4-Aminobenzotrifluoride hydrochloride
4-Aminobenzotrifluoride hydrochloride is commonly synthesized through the reaction of 4-bromobenzotrifluoride with an excess of sodium azide followed by acid workup to form the hydrochloride salt. The process involves the formation of azide intermediate and subsequent displacement of bromine by amines to produce the final product.

About

CAS No 90774-69-9
English Name 4-Aminobenzotrifluoride hydrochloride
Molecular Formula C7H7ClF3N
Molecular Weight 197.59 g/mol
SMILES C1=CC(=CC=C1C(F)(F)F)N.Cl
InChIKey CZGDYZDUMJDQSD-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9)?

4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9) is a crystalline solid with a molecular weig...

Compound Q&A

What industries use 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9)?

4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9) is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9)?

When handling 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9), ensure the use of appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...