Compound Q&A

What industries use 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9)?

Answer

4-Aminobenzotrifluoride hydrochloride
4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9) is primarily used in the pharmaceutical industry for the synthesis of various drug candidates. It is also utilized in the semiconductor industry for the preparation of organic electronic materials. Its reactivity makes it valuable in both academic and industrial research settings.

About

CAS No 90774-69-9
English Name 4-Aminobenzotrifluoride hydrochloride
Molecular Formula C7H7ClF3N
Molecular Weight 197.59 g/mol
SMILES C1=CC(=CC=C1C(F)(F)F)N.Cl
InChIKey CZGDYZDUMJDQSD-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9)?

4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9) is a crystalline solid with a molecular weig...

Compound Q&A

How is 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9) typically synthesized?

4-Aminobenzotrifluoride hydrochloride is commonly synthesized through the reaction of 4-bromobenzotr...

Compound Q&A

What precautions should be taken when handling 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9)?

When handling 4-Aminobenzotrifluoride hydrochloride (CAS: 90774-69-9), ensure the use of appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...