Compound Q&A

How is [2-(Benzyloxy)-5-chlorophenyl]boronic acid (CAS: 612832-83-4) typically synthesized?

Answer

[2-(Benzyloxy)-5-chlorophenyl]boronic acid
[2-(Benzyloxy)-5-chlorophenyl]boronic acid (CAS: 612832-83-4) is typically synthesized via a condensation reaction between 5-chlorobenzoic acid and benzyl alcohol, followed by boronation using a boronate ester. Common catalysts include sodium hydride and potassium tert-butoxide, with high selectivity and yield. The reaction is performed under an inert atmosphere to prevent oxidation and side reactions.

About

English Name [2-(Benzyloxy)-5-chlorophenyl]boronic acid
Molecular Formula C13H12BClO3
Molecular Weight 262.5 g/mol
SMILES ClC1=CC=C(OCC2=CC=CC=C2)C(B(O)O)=C1
InChIKey SLERXVFZNNSBIX-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of [2-(Benzyloxy)-5-chlorophenyl]boronic acid (CAS: 612832-83-4)?

[2-(Benzyloxy)-5-chlorophenyl]boronic acid (CAS: 612832-83-4) is a crystalline solid with a molecula...

Compound Q&A

What industries use [2-(Benzyloxy)-5-chlorophenyl]boronic acid (CAS: 612832-83-4)?

[2-(Benzyloxy)-5-chlorophenyl]boronic acid (CAS: 612832-83-4) is used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling [2-(Benzyloxy)-5-chlorophenyl]boronic acid (CAS: 612832-83-4)?

When handling [2-(Benzyloxy)-5-chlorophenyl]boronic acid (CAS: 612832-83-4), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...