Compound Q&A

What are the physical and chemical properties of [2-(Benzyloxy)-5-chlorophenyl]boronic acid (CAS: 612832-83-4)?

Answer

[2-(Benzyloxy)-5-chlorophenyl]boronic acid
[2-(Benzyloxy)-5-chlorophenyl]boronic acid (CAS: 612832-83-4) is a crystalline solid with a molecular weight of approximately 294.04 g/mol. It has a low solubility in water but is more soluble in organic solvents such as methanol and dichloromethane. Chemically, it is reactive towards nucleophiles and can undergo boronate ester formations. It is stable under normal laboratory conditions but should be stored in a cool, dark place to prevent degradation.

About

English Name [2-(Benzyloxy)-5-chlorophenyl]boronic acid
Molecular Formula C13H12BClO3
Molecular Weight 262.5 g/mol
SMILES ClC1=CC=C(OCC2=CC=CC=C2)C(B(O)O)=C1
InChIKey SLERXVFZNNSBIX-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is [2-(Benzyloxy)-5-chlorophenyl]boronic acid (CAS: 612832-83-4) typically synthesized?

[2-(Benzyloxy)-5-chlorophenyl]boronic acid (CAS: 612832-83-4) is typically synthesized via a condens...

Compound Q&A

What industries use [2-(Benzyloxy)-5-chlorophenyl]boronic acid (CAS: 612832-83-4)?

[2-(Benzyloxy)-5-chlorophenyl]boronic acid (CAS: 612832-83-4) is used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling [2-(Benzyloxy)-5-chlorophenyl]boronic acid (CAS: 612832-83-4)?

When handling [2-(Benzyloxy)-5-chlorophenyl]boronic acid (CAS: 612832-83-4), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...