Compound Q&A

What industries use 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5)?

Answer

6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan
6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of telmisartan. It is also explored for use in the development of novel drug candidates. Some research applications include its use in polymer and sensor technology, though commercial use in these areas is limited.

About

English Name 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan
Molecular Formula C26H24N2O4
Molecular Weight 428.49 g/mol
SMILES CCCC1=NC2=C(N1CC3=CC=C(C=C3)C4=CC=CC=C4C(=O)O)C=C(C=C2C)C(=O)O
InChIKey XVWHGXBWUBIPAA-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5)?

6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5) is a crystalline compound ...

Compound Q&A

How is 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5) typically synthesized?

6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan is typically synthesized via a multi-step pro...

Compound Q&A

What precautions should be taken when handling 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5)?

When handling 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5), it is essen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...