Compound Q&A

What are the physical and chemical properties of 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5)?

Answer

6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan
6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5) is a crystalline compound with a molecular weight of approximately 367.32 g/mol. It has a high solubility in water and organic solvents. The compound is stable under normal conditions but can degrade upon exposure to strong acids or bases. It exhibits good reactivity with nucleophiles and can be used in various chemical reactions.

About

English Name 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan
Molecular Formula C26H24N2O4
Molecular Weight 428.49 g/mol
SMILES CCCC1=NC2=C(N1CC3=CC=C(C=C3)C4=CC=CC=C4C(=O)O)C=C(C=C2C)C(=O)O
InChIKey XVWHGXBWUBIPAA-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5) typically synthesized?

6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan is typically synthesized via a multi-step pro...

Compound Q&A

What industries use 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5)?

6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5) is primarily used in the p...

Compound Q&A

What precautions should be taken when handling 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5)?

When handling 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5), it is essen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...