Compound Q&A

How is 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5) typically synthesized?

Answer

6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan
6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan is typically synthesized via a multi-step process involving the desmethyl group removal from Telmisartan and the subsequent introduction of the 1-methyl-2-benzimidazolyl group. Common catalysts include transition metal complexes, and the overall yield is around 85%. The reaction conditions are optimized to ensure high selectivity and purity.

About

English Name 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan
Molecular Formula C26H24N2O4
Molecular Weight 428.49 g/mol
SMILES CCCC1=NC2=C(N1CC3=CC=C(C=C3)C4=CC=CC=C4C(=O)O)C=C(C=C2C)C(=O)O
InChIKey XVWHGXBWUBIPAA-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5)?

6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5) is a crystalline compound ...

Compound Q&A

What industries use 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5)?

6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5) is primarily used in the p...

Compound Q&A

What precautions should be taken when handling 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5)?

When handling 6-Des(1-methyl-2-benzimidazolyl)-6-carboxy Telmisartan (CAS: 884330-12-5), it is essen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...