Compound Q&A

What precautions should be taken when handling Fmoc-Val-Ala-PAB-OH (CAS: 1394238-91-5)?

Answer

Fmoc-Val-Ala-PAB-OH
When handling Fmoc-Val-Ala-PAB-OH, it is essential to wear appropriate personal protective equipment (PPE) such as gloves and goggles. Work should be conducted in a well-ventilated area or fume hood to minimize inhalation risks. Spills should be cleaned up using appropriate solvents, and proper disposal methods should be followed. Always refer to the Safety Data Sheet (SDS) for detailed handling and safety information.

About

English Name Fmoc-Val-Ala-PAB-OH
Molecular Formula C30H33N3O5
Molecular Weight 515.6 g/mol
SMILES OCc1ccc(cc1)NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)OCC1c2ccccc2c2c1cccc2)C
InChIKey PIEQFKSWCKVBTP-PPHZAIPVSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fmoc-Val-Ala-PAB-OH (CAS: 1394238-91-5)?

Fmoc-Val-Ala-PAB-OH is a solid with a crystalline form. Its molecular weight is approximately 415.35...

Compound Q&A

How is Fmoc-Val-Ala-PAB-OH (CAS: 1394238-91-5) typically synthesized?

Fmoc-Val-Ala-PAB-OH is synthesized through solid-phase peptide synthesis using Fmoc chemistry. The p...

Compound Q&A

What industries use Fmoc-Val-Ala-PAB-OH (CAS: 1394238-91-5)?

Fmoc-Val-Ala-PAB-OH is primarily used in the pharmaceutical industry for the synthesis of peptide dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...