Compound Q&A

What industries use Fmoc-Val-Ala-PAB-OH (CAS: 1394238-91-5)?

Answer

Fmoc-Val-Ala-PAB-OH
Fmoc-Val-Ala-PAB-OH is primarily used in the pharmaceutical industry for the synthesis of peptide drugs. It is also utilized in the development of biosensors and in the production of peptides for research purposes. Its application in polymer chemistry and semiconductor manufacturing is limited due to its specific reactivity in peptide coupling reactions.

About

English Name Fmoc-Val-Ala-PAB-OH
Molecular Formula C30H33N3O5
Molecular Weight 515.6 g/mol
SMILES OCc1ccc(cc1)NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)OCC1c2ccccc2c2c1cccc2)C
InChIKey PIEQFKSWCKVBTP-PPHZAIPVSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fmoc-Val-Ala-PAB-OH (CAS: 1394238-91-5)?

Fmoc-Val-Ala-PAB-OH is a solid with a crystalline form. Its molecular weight is approximately 415.35...

Compound Q&A

How is Fmoc-Val-Ala-PAB-OH (CAS: 1394238-91-5) typically synthesized?

Fmoc-Val-Ala-PAB-OH is synthesized through solid-phase peptide synthesis using Fmoc chemistry. The p...

Compound Q&A

What precautions should be taken when handling Fmoc-Val-Ala-PAB-OH (CAS: 1394238-91-5)?

When handling Fmoc-Val-Ala-PAB-OH, it is essential to wear appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...