Compound Q&A

How is Fmoc-Val-Ala-PAB-OH (CAS: 1394238-91-5) typically synthesized?

Answer

Fmoc-Val-Ala-PAB-OH
Fmoc-Val-Ala-PAB-OH is synthesized through solid-phase peptide synthesis using Fmoc chemistry. The process involves coupling the amino acid Val-Ala-PAB to a solid support, followed by deprotection with hydroxylamine to introduce the PAB group. Commonly used reagents include Fmoc-protected amino acids and coupling agents like HBTU or DIC.

About

English Name Fmoc-Val-Ala-PAB-OH
Molecular Formula C30H33N3O5
Molecular Weight 515.6 g/mol
SMILES OCc1ccc(cc1)NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)OCC1c2ccccc2c2c1cccc2)C
InChIKey PIEQFKSWCKVBTP-PPHZAIPVSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fmoc-Val-Ala-PAB-OH (CAS: 1394238-91-5)?

Fmoc-Val-Ala-PAB-OH is a solid with a crystalline form. Its molecular weight is approximately 415.35...

Compound Q&A

What industries use Fmoc-Val-Ala-PAB-OH (CAS: 1394238-91-5)?

Fmoc-Val-Ala-PAB-OH is primarily used in the pharmaceutical industry for the synthesis of peptide dr...

Compound Q&A

What precautions should be taken when handling Fmoc-Val-Ala-PAB-OH (CAS: 1394238-91-5)?

When handling Fmoc-Val-Ala-PAB-OH, it is essential to wear appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...