Compound Q&A

What precautions should be taken when handling 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6)?

Answer

5,10,15,20-Tetrakis(4-methylphenyl)porphyrin
When handling 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Work should be conducted in a fume hood to minimize inhalation risks. Spills should be cleaned up using appropriate absorbents, and the area should be well-ventilated. Always refer to the Safety Data Sheet (SDS) for specific handling instructions and emergency procedures.

About

CAS No 14527-51-6
English Name 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin
Molecular Formula C48H38N4
Molecular Weight 670.86 g/mol
SMILES CC1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=C(C=C7)C)C8=CC=C(C=C8)C)C=C4)C9=CC=C(C=C9)C)N3
InChIKey SFQNUQLWBBZIOZ-PJEPRTEXSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6)?

5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6) is a solid with a crystalline form. I...

Compound Q&A

How is 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6) typically synthesized?

5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6) is synthesized through a complex mult...

Compound Q&A

What industries use 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6)?

5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6) finds applications in the pharmaceuti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...