Compound Q&A

How is 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6) typically synthesized?

Answer

5,10,15,20-Tetrakis(4-methylphenyl)porphyrin
5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6) is synthesized through a complex multistep process involving the condensation of 4-methylphenyl glycine with metal-free porphyrin framework. The synthesis typically requires careful control of reaction conditions to achieve high yields and selectivity. Commonly used catalysts include transition metals like iron or cobalt.

About

CAS No 14527-51-6
English Name 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin
Molecular Formula C48H38N4
Molecular Weight 670.86 g/mol
SMILES CC1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=C(C=C7)C)C8=CC=C(C=C8)C)C=C4)C9=CC=C(C=C9)C)N3
InChIKey SFQNUQLWBBZIOZ-PJEPRTEXSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6)?

5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6) is a solid with a crystalline form. I...

Compound Q&A

What industries use 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6)?

5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6) finds applications in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6)?

When handling 5,10,15,20-Tetrakis(4-methylphenyl)porphyrin (CAS: 14527-51-6), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...